diff --git a/src/fr/inrialpes/exmo/align/util/OntologyNetworkWeakener.java b/src/fr/inrialpes/exmo/align/util/OntologyNetworkWeakener.java new file mode 100644 index 0000000000000000000000000000000000000000..6a583cfcb7c369ddf17cec2cf7d8d570c0df76d5 --- /dev/null +++ b/src/fr/inrialpes/exmo/align/util/OntologyNetworkWeakener.java @@ -0,0 +1,88 @@ +/* + * $Id$ + * + * Copyright (C) INRIA, 2009 + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU Lesser General Public License + * as published by the Free Software Foundation; either version 2.1 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, but + * WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + * Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public + * License along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 + * USA. + */ + +package fr.inrialpes.exmo.align.util; + +import org.semanticweb.owl.align.Alignment; +import org.semanticweb.owl.align.AlignmentException; +import org.semanticweb.owl.align.Cell; +import org.semanticweb.owl.align.OntologyNetwork; + +import fr.inrialpes.exmo.align.impl.BasicOntologyNetwork; + +import java.net.URI; +import java.util.Set; +import java.util.Collections; +import java.util.ArrayList; + +/** + * OntologyNetworkWeakener + * + * A utility class that transform an ontology network in one with less alignments/ + */ +public class OntologyNetworkWeakener { + + /** + * suppress n% of the correspondences at random in all alignments + */ + public static OntologyNetwork unconnect( OntologyNetwork on, int n ){ + return on; + } + + /** + * suppress n% of the correspondences at random in all alignments + * n is a number between 0. and 1. + * Returns a brand new BasicOntologyNetwork (with new alignments and cells) + */ + public static OntologyNetwork weakenAlignments( OntologyNetwork on, double n ) throws AlignmentException { + if ( n < 0. || n > 1. ) + throw new AlignmentException( "Argument must be between 0 and 1.: "+n ); + OntologyNetwork newon = new BasicOntologyNetwork(); + for ( URI ontouri : on.getOntologies() ){ + newon.addOntology( ontouri ); + } + for ( Alignment al : on.getAlignments() ){ + Alignment newal = (Alignment)al.clone(); + int size = newal.nbCells(); + // -------------------------------------------------------------------- + // JE: Here is a tricky one. + // Using collection schuffle randomly reorganises a list + // Then choosing the fist n% and destroying them in the Set is performed + // The complexity is O(copy=N)+O(shuffle=N)+n%*O(delete=N) + // That's not bad... (and also avoid checking if the same nb is drawn) + // But in practice other solutions may be better, like: + // Generating randomly n%*N numbers between 0 and N (util.Random) + // Ordering them + // Traversing the initial structure and deleting the choosen ones... + // This one (deleting when traversing) is tricky in Java. + // -------------------------------------------------------------------- + ArrayList<Cell> array = new ArrayList<Cell>( size ); + for ( Cell c : newal ) { + array.add( c ); + } + Collections.shuffle( array ); + for ( int i = (int)(n*size); i > 0; i-- ){ + newal.remCell( array.get( i ) ); + } + } + return newon; + } +}